For research use only. Not for therapeutic Use.
3-Phenylcyclohexanone(Cat No.:L030816)is an organic compound featuring a cyclohexanone ring with a phenyl group attached at the 3-position. This compound is widely used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. Its structure allows for diverse chemical modifications, making it valuable in the synthesis of complex molecules and bioactive compounds. 3-Phenylcyclohexanone is essential for researchers and chemists working on drug discovery, offering a versatile building block for creating novel therapeutic agents and advanced materials.
CAS Number | 20795-53-3 |
Molecular Formula | C12H14O |
Purity | ≥95% |
IUPAC Name | 3-phenylcyclohexan-1-one |
InChI | InChI=1S/C12H14O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2 |
InChIKey | CJAUDSQXFVZPTO-UHFFFAOYSA-N |
SMILES | C1CC(CC(=O)C1)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |