For research use only. Not for therapeutic Use.
3-Phenylpyridine-5-carboxaldehyde is an aromatic heterocyclic compound used in pharmaceutical research and organic synthesis. Its structure, featuring a phenyl group attached to a pyridine ring with a carboxaldehyde functional group at the 5-position, makes it a versatile intermediate for the development of bioactive molecules. This compound is frequently employed in the synthesis of ligands, catalysts, and therapeutic agents. Its reactivity allows for further chemical modifications, supporting advancements in medicinal chemistry and the creation of novel drug candidates.
CAS Number | 113118-84-6 |
Molecular Formula | C12H9NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-phenylpyridine-3-carbaldehyde |
InChI | InChI=1S/C12H9NO/c14-9-10-6-12(8-13-7-10)11-4-2-1-3-5-11/h1-9H |
InChIKey | ACFVOZGSDCHVGJ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)C=O |