For research use only. Not for therapeutic Use.
3-Phthalimidopropionic acid(CAT: M136619) is an organic compound featuring a phthalimide group attached to a propionic acid chain. This structure makes it useful as an intermediate in organic synthesis, particularly for the preparation of various pharmaceuticals and agrochemicals. The phthalimide moiety acts as a protecting group for amines, allowing selective reactions at other sites, while the carboxylic acid group provides versatility for further modifications. This compound is commonly used in peptide synthesis, as well as in the creation of bioactive molecules, due to its stability and reactivity. Its applications extend to medicinal chemistry and chemical research involving the synthesis of complex molecular structures.
CAS Number | 3339-73-9 |
Molecular Formula | C11H9NO4 |
Purity | ≥95% |
IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propanoic acid |
InChI | InChI=1S/C11H9NO4/c13-9(14)5-6-12-10(15)7-3-1-2-4-8(7)11(12)16/h1-4H,5-6H2,(H,13,14) |
InChIKey | DXXHRZUOTPMGEH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=O)O |