For research use only. Not for therapeutic Use.
3-Picoline 1-oxide (Cat No.:R047225) is a chemical compound. It is a derivative of picoline, featuring an oxygen atom attached to the carbon ring. This compound is important in organic synthesis and chemical research due to its potential applications in various reactions. Picoline derivatives are utilized as building blocks in the synthesis of pharmaceuticals, agrochemicals, and other functional molecules. The presence of an oxygen atom adds reactivity and functional diversity to the compound. 3-Picoline 1-oxide’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 1003-73-2 |
Synonyms | 3-Methylpyridine 1-Oxide; 3-Methylpyridine N-Oxide; 3-Picoline N-Oxide; NSC 18254; β-Picoline 1-Oxide; β-Picoline N-Oxide; β-Picoline Oxide; |
Molecular Formula | C6H7NO |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 3-methyl-1-oxidopyridin-1-ium |
InChI | InChI=1S/C6H7NO/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 |
InChIKey | DMGGLIWGZFZLIY-UHFFFAOYSA-N |
SMILES | CC1=C[N+](=CC=C1)[O-] |