Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 3-(Piperidin-4-yl)propanoic acid hydrochloride
For research use only. Not for therapeutic Use.
3-(Piperidin-4-yl)propanoic acid hydrochloride (Cat.No:L038516) is a chemical compound used in the synthesis of pharmaceutical intermediates and organic molecules. Its piperidine moiety makes it a valuable building block for drug discovery and development. This compound’s versatile reactivity contributes to its significance in various synthetic processes.
Catalog Number | L038516 |
CAS Number | 51052-79-0 |
Molecular Formula | C8H16ClNO2 |
Purity | ≥95% |
IUPAC Name | 3-piperidin-4-ylpropanoic acid;hydrochloride |
InChI | InChI=1S/C8H15NO2.ClH/c10-8(11)2-1-7-3-5-9-6-4-7;/h7,9H,1-6H2,(H,10,11);1H |
InChIKey | XJKGRWLZAWTSOY-UHFFFAOYSA-N |