Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 3-(Piperidin-4-yl)pyridine hydrochloride
For research use only. Not for therapeutic Use.
3-(Piperidin-4-yl)pyridine hydrochloride (Cat No.:L029747) is an organic compound with a pyridine ring substituted with a piperidine group at position 4. In the hydrochloride salt form, it enhances stability and solubility. This compound finds applications in pharmaceutical research, where the unique structure suggests potential bioactivity. The presence of both pyridine and piperidine moieties makes it interesting for medicinal chemistry, offering opportunities for further chemical modifications and exploration in drug discovery. Its use as a building block or lead compound could lead to the synthesis of diverse bioactive molecules with pharmacological properties.
Catalog Number | L029747 |
CAS Number | 690261-73-5 |
Molecular Formula | C10H15ClN2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 3-piperidin-4-ylpyridine;hydrochloride |
InChI | InChI=1S/C10H14N2.ClH/c1-2-10(8-12-5-1)9-3-6-11-7-4-9;/h1-2,5,8-9,11H,3-4,6-7H2;1H |
InChIKey | BBALAFIFDKQHGR-UHFFFAOYSA-N |
SMILES | C1CNCCC1C2=CN=CC=C2.Cl |