Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> 3-Piperidineacetic Acid-d11
For research use only. Not for therapeutic Use.
3-Piperidineacetic Acid-d11 is a deuterated compound where eleven hydrogen atoms are replaced with deuterium, enhancing its utility in analytical and synthetic chemistry. It acts as an internal standard in mass spectrometry and NMR spectroscopy, ensuring precise quantification and structural elucidation due to its stable isotope labeling. In pharmaceutical chemistry, it is valuable for metabolic studies and drug development research. In organic chemistry, it is utilized in reaction mechanism studies and isotope dilution assays. Its stability and deuterium content make it essential for high-precision analytical applications in various scientific fields.
CAS Number | 74494-52-3 |
Synonyms | 2-(Piperidin-3-yl)acetic Acid-d11; NSC 138735-d11; (Piperidin-3-yl)acetic Acid-d11 |
Molecular Formula | C7H13NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-piperidin-3-ylacetic acid |
InChI | InChI=1S/C7H13NO2/c9-7(10)4-6-2-1-3-8-5-6/h6,8H,1-5H2,(H,9,10) |
InChIKey | WKXRHAACRPUBIC-UHFFFAOYSA-N |
SMILES | C1CC(CNC1)CC(=O)O |