For research use only. Not for therapeutic Use.
3-Propionylbenzamide (CAT: L000264) is a compound commonly used in organic chemistry and may also have applications in pharmaceutical research. In organic chemistry, it serves as an intermediate for the synthesis of various organic compounds. Its acyl group can be utilized in various reactions to introduce specific functionality into organic molecules
| Catalog Number | L000264 |
| CAS Number | 344409-01-4 |
| Molecular Formula | C10H11NO2 |
| Purity | ≥95% |
| IUPAC Name | 3-propanoylbenzamide |
| InChI | InChI=1S/C10H11NO2/c1-2-9(12)7-4-3-5-8(6-7)10(11)13/h3-6H,2H2,1H3,(H2,11,13) |
| InChIKey | PPVWXHGGVUVZBP-UHFFFAOYSA-N |
