For research use only. Not for therapeutic Use.
3-(Pyridin-2-ylmethoxy)aniline(Cat No.:L007734), is a chemical compound characterized by an aniline moiety (an aromatic amine) with a methoxy group attached to the phenyl ring at position 3 and a pyridine-2-yl group attached via an oxygen atom. This compound is part of the broader class of organic molecules known for their significance in medicinal and pharmaceutical chemistry. Anilines and their derivatives often serve as key intermediates in the synthesis of various pharmaceuticals, agrochemicals, and dyes. The presence of both aniline and pyridine functionalities makes this compound valuable in the design and synthesis of potential bioactive molecules.
CAS Number | 105326-56-5 |
Molecular Formula | C12H12N2O |
Purity | ≥95% |
IUPAC Name | 3-(pyridin-2-ylmethoxy)aniline |
InChI | InChI=1S/C12H12N2O/c13-10-4-3-6-12(8-10)15-9-11-5-1-2-7-14-11/h1-8H,9,13H2 |
InChIKey | HGHLFKVWEXFLES-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)COC2=CC=CC(=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |