For research use only. Not for therapeutic Use.
(3-((Pyridin-4-ylthio)methyl)phenyl)methanol(Cat No.:L034581)is a chemical compound featuring a phenyl ring linked to a pyridinylthio group via a methylene bridge, with a hydroxymethyl group attached to the phenyl ring. This compound is used in pharmaceutical research and organic synthesis as an intermediate for developing complex molecules, including potential drug candidates. Its unique structure allows for versatile reactivity in various chemical transformations, making it valuable in medicinal chemistry. Researchers utilize this compound to explore innovative therapeutic agents and advanced materials, contributing to drug discovery and development.
CAS Number | 811801-40-8 |
Molecular Formula | C13H13NOS |
Purity | ≥95% |
IUPAC Name | [3-(pyridin-4-ylsulfanylmethyl)phenyl]methanol |
InChI | InChI=1S/C13H13NOS/c15-9-11-2-1-3-12(8-11)10-16-13-4-6-14-7-5-13/h1-8,15H,9-10H2 |
InChIKey | DHIDEDJMZMWOAM-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)CSC2=CC=NC=C2)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |