For research use only. Not for therapeutic Use.
3-Pyridineacrylic acid (Cat No.:R023979) is a chemical compound. It features a pyridine ring substituted with an acrylic acid functional group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Pyridine derivatives are used as building blocks in the synthesis of pharmaceuticals, agrochemicals, and other functional molecules. The presence of an acrylic acid group adds reactivity and functional diversity to the compound. 3-Pyridineacrylic acid’s role as a synthetic intermediate contributes to the creation of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 1126-74-5 |
Synonyms | 3-(3-Pyridyl)-2-propenoic Acid; 3-(3-Pyridyl)acrylic Acid; 3-(3’-Pyridyl)acrylic Acid; 3-(Pyridin-3-yl)acrylic Acid; Pyridyl-3-acrylic Acid; β-(3-Pyridyl)-acrylic Acid; ω-(3-Pyridyl)acrylic Acid |
Molecular Formula | C8H7NO2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | (E)-3-pyridin-3-ylprop-2-enoic acid |
InChI | InChI=1S/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11)/b4-3+ |
InChIKey | VUVORVXMOLQFMO-ONEGZZNKSA-N |
SMILES | C1=CC(=CN=C1)C=CC(=O)O |