For research use only. Not for therapeutic Use.
3-Pyridylamidoxime(CAT: M050052) is an organic compound featuring a pyridine ring attached to an amidoxime functional group. This molecule is valuable in chemical research and synthesis, especially in the design of metal chelators and ligands due to its strong ability to bind to metals. The amidoxime group introduces versatile reactivity, making the compound useful in coordination chemistry and catalysis. It is also employed in the development of pharmaceuticals, where it can serve as a building block in the synthesis of bioactive compounds. Its potential applications extend to fields like medicinal chemistry and material science.
CAS Number | 1594-58-7 |
Synonyms | N-Hydroxynicotinamidine;NSC 208697;NSC 220324 |
Molecular Formula | C6H7N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N'-hydroxypyridine-3-carboximidamide |
InChI | InChI=1S/C6H7N3O/c7-6(9-10)5-2-1-3-8-4-5/h1-4,10H,(H2,7,9) |
InChIKey | AQBMQGDKWIPBRF-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(=NO)N |