For research use only. Not for therapeutic Use.
3-Pyrrolidin-1-ylmethyl-benzylamine is an organic compound featuring a benzylamine structure with a pyrrolidine moiety attached at the third position. Its chemical formula is C₁₁H₁₅N₃. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, particularly as a building block for the synthesis of bioactive molecules. The presence of the pyrrolidine ring enhances its reactivity and binding characteristics, making it valuable for exploring various therapeutic applications, including central nervous system-related treatments.
Catalog Number | L012666 |
CAS Number | 91271-78-2 |
Molecular Formula | C12H18N2 |
Purity | ≥95% |
IUPAC Name | [3-(pyrrolidin-1-ylmethyl)phenyl]methanamine |
InChI | InChI=1S/C12H18N2/c13-9-11-4-3-5-12(8-11)10-14-6-1-2-7-14/h3-5,8H,1-2,6-7,9-10,13H2 |
InChIKey | RTUWXPVILJUANC-UHFFFAOYSA-N |
SMILES | C1CCN(C1)CC2=CC=CC(=C2)CN |