For research use only. Not for therapeutic Use.
3-(Pyrrolidin-1-yl)propanoic Acid(CAT: L014730) is a high-purity amino acid derivative widely utilized in pharmaceutical, chemical, and biochemical research. Featuring a pyrrolidine ring attached to a propanoic acid backbone, this compound serves as a versatile intermediate for synthesizing bioactive molecules, fine chemicals, and pharmaceutical agents. Its unique structure is particularly valuable in medicinal chemistry for developing therapeutic compounds and exploring structure-activity relationships. With excellent stability and reactivity, 3-(Pyrrolidin-1-yl)propanoic Acid ensures precision and reliability, making it a critical tool for advanced research and innovative synthetic applications.
CAS Number | 76234-38-3 |
Molecular Formula | C7H13NO2 |
Purity | ≥95% |
IUPAC Name | 3-pyrrolidin-1-ylpropanoic acid |
InChI | InChI=1S/C7H13NO2/c9-7(10)3-6-8-4-1-2-5-8/h1-6H2,(H,9,10) |
InChIKey | BRSKDXVJFXXUKX-UHFFFAOYSA-N |
SMILES | C1CCN(C1)CCC(=O)O |