For research use only. Not for therapeutic Use.
3-Sulfolene-D6 is a high-purity, deuterium-labeled derivative of 3-sulfolene, essential for advanced chemical and biochemical research. This compound, featuring six deuterium atoms, is crucial for studying reaction mechanisms, sulfur chemistry, and metabolic pathways. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in organic synthesis, polymer science, and analytical chemistry, 3-Sulfolene-D6 enhances the accuracy of experimental data, supporting advancements in scientific investigations and industrial applications.
CAS Number | 41908-25-2 |
Synonyms | 2,5-Dihydro-D2-thiophene-D4 1,1-Dioxide |
Molecular Formula | C4H6O2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2,3,4,5,5-hexadeuteriothiophene 1,1-dioxide |
InChI | InChI=1S/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2/i1D,2D,3D2,4D2 |
InChIKey | MBDNRNMVTZADMQ-TZCZJOIZSA-N |
SMILES | C1C=CCS1(=O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |