For research use only. Not for therapeutic Use.
3-{[(Tert-butoxy)carbonyl]amino}(Cat No.:L030342)is a key functional group commonly used in organic synthesis, particularly in the field of pharmaceutical research. This compound, featuring a tert-butoxycarbonyl (Boc) protecting group attached to an amino group, is crucial for the temporary protection of amines during complex synthetic processes. It allows for selective reactions and facilitates the creation of intricate molecular structures. 3-{[(Tert-butoxy)carbonyl]amino} is widely employed in peptide synthesis and drug development, offering researchers a reliable tool for high-precision chemical modifications and advanced research applications.
CAS Number | 303752-38-7 |
Molecular Formula | C11H17NO4 |
Purity | ≥95% |
IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[1.1.1]pentane-1-carboxylic acid |
InChI | InChI=1S/C11H17NO4/c1-9(2,3)16-8(15)12-11-4-10(5-11,6-11)7(13)14/h4-6H2,1-3H3,(H,12,15)(H,13,14) |
InChIKey | CKXLBAVWWJDBHS-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C(=O)O |