For research use only. Not for therapeutic Use.
3-Thien-3-ylpropanoic acid(Cat No.:M081023)is a thiophene-based organic acid where a thiophene ring is linked to a propanoic acid chain. This compound is of interest due to its potential as a building block in the synthesis of various pharmaceutical and agrochemical products. The presence of the thiophene ring, a sulfur-containing heterocycle, contributes to the compound’s electronic properties and enhances its ability to interact with biological systems, making it valuable for drug design. 3-Thien-3-ylpropanoic acid is particularly useful in developing anti-inflammatory and antimicrobial agents, exploring its unique chemical functionality.
Catalog Number | M081023 |
CAS Number | 16378-06-6 |
Molecular Formula | C7H8O2S |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 3-thiophen-3-ylpropanoic acid |
InChI | InChI=1S/C7H8O2S/c8-7(9)2-1-6-3-4-10-5-6/h3-5H,1-2H2,(H,8,9) |
InChIKey | YUSDDNTYMDWOCY-UHFFFAOYSA-N |
SMILES | C1=CSC=C1CCC(=O)O |