For research use only. Not for therapeutic Use.
3-Thiopheneacrylic acid(Cat No.:M049275)is an organic compound that features a thiophene ring attached to an acrylic acid group. It is often used in organic synthesis and serves as a versatile intermediate for developing various chemical derivatives. This compound has potential applications in materials science, particularly in the synthesis of conducting polymers and organic semiconductors. Additionally, it can be utilized in drug discovery, especially in designing novel molecules with biological activity. Research into its properties indicates that it may also play a role in the development of anti-inflammatory and anticancer agents.
CAS Number | 1195-52-4 |
Synonyms | (E)-3-thiophen-3-ylprop-2-enoic acid |
Molecular Formula | C7H6O2S |
Purity | ≥95% |
IUPAC Name | (E)-3-thiophen-3-ylprop-2-enoic acid |
InChI | InChI=1S/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1+ |
InChIKey | VYRYYUKILKRGDN-OWOJBTEDSA-N |
SMILES | C1=CSC=C1/C=C/C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |