3-(Triethylammonium)propyl Methanthiosulfonate Bromide (Cat. No: R000497) is a hydroxyl active reagent, which can be used as MTS reagent to detect the topological structure and function of some ligand-gated ion channels and transporters and can also be used for the treatment of glaucoma.
| Catalog Number | R000497 |
| CAS Number | 219789-15-8 |
| Synonyms | MTS-PTrEA; N,N,N-Triethyl-3-[(methylsulfonyl)thio]-1-propanaminium Bromide |
| Molecular Formula | C10H24BrNO2S2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | triethyl(3-methylsulfonylsulfanylpropyl)azanium;bromide |
| InChI | InChI=1S/C10H24NO2S2.BrH/c1-5-11(6-2,7-3)9-8-10-14-15(4,12)13;/h5-10H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HSMSYCCXSSOJQO-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CCCSS(=O)(=O)C.[Br-] |
