For research use only. Not for therapeutic Use.
3-(Trifluoromethyl)quinolin-5-amine(Cat No.:L025875)is a fluorinated quinoline derivative widely used in pharmaceutical research and development. The trifluoromethyl group attached to the quinoline ring enhances the compound’s lipophilicity and metabolic stability, making it a crucial building block for synthesizing various bioactive molecules. This compound is particularly valuable in the design of drugs targeting cancer, infectious diseases, and central nervous system disorders. Its high purity and consistent performance provide researchers with a reliable tool for advancing medicinal chemistry and exploring new therapeutic avenues.
CAS Number | 1824276-05-2 |
Molecular Formula | C10H7F3N2 |
Purity | ≥95% |
IUPAC Name | 3-(trifluoromethyl)quinolin-5-amine |
InChI | InChI=1S/C10H7F3N2/c11-10(12,13)6-4-7-8(14)2-1-3-9(7)15-5-6/h1-5H,14H2 |
InChIKey | CQMXQQDABAFPMA-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C=C(C=NC2=C1)C(F)(F)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |