For research use only. Not for therapeutic Use.
3-Vinylphenol is an aromatic compound featuring a vinyl group attached to the third position of a phenol ring. It is primarily used as an intermediate in the synthesis of polymers and resins, particularly for producing heat-resistant materials and coatings. Due to its reactive vinyl group, 3-Vinylphenol can undergo polymerization, making it useful in creating specialized polymeric structures. It is also found in trace amounts in certain natural products and may arise as a byproduct in the degradation of lignin. Additionally, this compound is of interest in flavor chemistry due to its potential role in the formation of off-flavors in food products.
CAS Number | 620-18-8 |
Synonyms | 3-Ethenylphenol; 3-Hydroxystyrene; m-Hydroxystyrene; m-Vinylphenol; m-Ethenylphenol; |
Molecular Formula | C8H8O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-ethenylphenol |
InChI | InChI=1S/C8H8O/c1-2-7-4-3-5-8(9)6-7/h2-6,9H,1H2 |
InChIKey | YNGIFMKMDRDNBQ-UHFFFAOYSA-N |
SMILES | C=CC1=CC(=CC=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |