Home
>
Chemical Reagents>Organic Building Blocks> 3,3'-(Azanediylbis(methylene))dibenzenesulfonamide
For research use only. Not for therapeutic Use.
3,3′-(Azanediylbis(methylene))dibenzenesulfonamide is an organic compound featuring a central azanediyl (or diamine) group connecting two methylene units, each linked to a dibenzenesulfonamide moiety. Its chemical formula is C₁₄H₁₈N₂O₄S. This compound is significant in medicinal chemistry due to its potential biological activities, including antitumor and antibacterial properties. The sulfonamide functionality enhances its solubility and reactivity, making it a valuable scaffold for drug development and synthesis of bioactive molecules. Its structural versatility allows for further functionalization and modification.
Catalog Number | L018341 |
CAS Number | 857003-88-4 |
Molecular Formula | C14H17N3O4S2 |
Purity | ≥95% |
IUPAC Name | 3-[[(3-sulfamoylphenyl)methylamino]methyl]benzenesulfonamide |
InChI | InChI=1S/C14H17N3O4S2/c15-22(18,19)13-5-1-3-11(7-13)9-17-10-12-4-2-6-14(8-12)23(16,20)21/h1-8,17H,9-10H2,(H2,15,18,19)(H2,16,20,21) |
InChIKey | VDLPFKRXQORLOH-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)CNCC2=CC(=CC=C2)S(=O)(=O)N |