For research use only. Not for therapeutic Use.
3,3-Azo-1-butanol is an organic compound featuring an azo group (-N=N-) linked to a butanol moiety. This compound is of interest in chemical synthesis and research due to its unique structure, which allows it to act as an intermediate in the preparation of various derivatives. The azo group in 3,3-Azo-1-butanol can undergo reduction or other chemical transformations, making it a versatile building block in organic chemistry. It is particularly useful in the synthesis of dyes, polymers, and other specialty chemicals. Additionally, its potential applications extend to material science, where it may be utilized in the design of novel functional materials.
CAS Number | 25055-82-7 |
Synonyms | 3-Methyl-3-azibutanol; 3H-Diazirine-3-ethanol; |
Molecular Formula | C4H8N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3-methyldiazirin-3-yl)ethanol |
InChI | InChI=1S/C4H8N2O/c1-4(2-3-7)5-6-4/h7H,2-3H2,1H3 |
InChIKey | YXAYZDNOWMFZLL-UHFFFAOYSA-N |
SMILES | CC1(N=N1)CCO |