For research use only. Not for therapeutic Use.
3,3′-Azotoluene(Cat No.:I020854) is a bioactive chemical compound that possesses biological activity and potential therapeutic applications. It is an azo compound derived from toluene, containing a nitrogen-nitrogen double bond. The specific bioactive properties and mechanisms of action of 3,3′-Azotoluene can vary depending on its specific interactions with biological targets.
CAS Number | 588-04-5 |
Synonyms | 3,3'-Azotoluene |
Molecular Formula | C14H14N2 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 3,3'-Azotoluene |
InChI | InChI=1S/C14H14N2/c1-11-5-3-7-13(9-11)15-16-14-8-4-6-12(2)10-14/h3-10H,1-2H3/b16-15+ |
InChIKey | HPSZIXYLILUGIP-FOCLMDBBSA-N |
SMILES | CC1=CC=CC(/N=N/C2=CC(C)=CC=C2)=C1 |