Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3,3-Bis(trifluoromethyl)pyrrolidine hydrochloride
For research use only. Not for therapeutic Use.
3,3-Bis(trifluoromethyl)pyrrolidine hydrochloride(Cat No.:L007561), is a chemical compound notable for its unique molecular structure. It features two trifluoromethyl groups attached to a pyrrolidine ring, enhancing its chemical reactivity and stability. This compound is utilized in pharmaceutical research and development due to its potential applications in medicinal chemistry. Researchers often study its properties for drug discovery and synthesis.
CAS Number | 1315368-84-3 |
Molecular Formula | C6H8ClF6N |
Purity | ≥95% |
IUPAC Name | 3,3-bis(trifluoromethyl)pyrrolidine;hydrochloride |
InChI | InChI=1S/C6H7F6N.ClH/c7-5(8,9)4(6(10,11)12)1-2-13-3-4;/h13H,1-3H2;1H |
InChIKey | IOELUPWFNZWTOB-UHFFFAOYSA-N |
SMILES | C1CNCC1(C(F)(F)F)C(F)(F)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |