For research use only. Not for therapeutic Use.
3,3-Diethoxypropionitrile is a specialized organic compound characterized by the presence of two ethoxy groups attached to a carbon next to a cyano group. This structure makes it a valuable nitrile in synthetic organic chemistry, commonly used as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity with various chemical agents allows for the synthesis of more complex molecules, particularly in the formation of heterocyclic compounds, making it a crucial component in diverse chemical syntheses.
CAS Number | 2032-34-0 |
Synonyms | 3,3-Diethoxypropanenitrile; Cyanoacetaldehyde Diethyl Acetal; Malonaldehydenitrile Diethyl Acetal; |
Molecular Formula | C7H13NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,3-diethoxypropanenitrile |
InChI | InChI=1S/C7H13NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-5H2,1-2H3 |
InChIKey | WBOXEOCWOCJQNK-UHFFFAOYSA-N |
SMILES | CCOC(CC#N)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |