For research use only. Not for therapeutic Use.
(3,3-Difluorocyclobutyl)methanol (CAT: R063069) is a chemical compound with significance in the field of organic chemistry. It is characterized by the presence of a cyclobutyl ring and two fluorine atoms. Compounds like this can serve as valuable building blocks in the synthesis of more complex organic molecules, especially those used in pharmaceuticals and materials chemistry.
Catalog Number | R063069 |
CAS Number | 681128-39-2 |
Synonyms | 3,3-Difluoro-cyclobutanemethanol |
Molecular Formula | C5H8F2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3,3-difluorocyclobutyl)methanol |
InChI | InChI=1S/C5H8F2O/c6-5(7)1-4(2-5)3-8/h4,8H,1-3H2 |
InChIKey | MDZKTVVUZBIKGI-UHFFFAOYSA-N |
SMILES | C1C(CC1(F)F)CO |