For research use only. Not for therapeutic Use.
3,3'-Dihydroxybenzidine is a bioactive chemical.
| Catalog Number | I020855 |
| CAS Number | 2373-98-0 |
| Synonyms | 3,3'-Dihydroxybenzidine |
| Molecular Formula | C12H12N2O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3,3'-Dihydroxybenzidine |
| InChI | InChI=1S/C12H12N2O2/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6,15-16H,13-14H2 |
| InChIKey | ZGDMDBHLKNQPSD-UHFFFAOYSA-N |
| SMILES | NC1=CC=C(C2=CC=C(N)C(O)=C2)C=C1O |
