For research use only. Not for therapeutic Use.
3,3-Dimethyl-2-phenylbutanoic acid (Cat.No:L004189) is a crucial compound in pharmaceutical research. Its distinct structure, combining a branched alkyl chain and a phenyl group, imparts unique properties. This compound is employed as a valuable intermediate in the synthesis of specialized pharmaceutical agents, particularly in the field of anti-inflammatory drugs.
CAS Number | 13490-70-5 |
Molecular Formula | C12H16O2 |
Purity | ≥95% |
IUPAC Name | 3,3-dimethyl-2-phenylbutanoic acid |
InChI | InChI=1S/C12H16O2/c1-12(2,3)10(11(13)14)9-7-5-4-6-8-9/h4-8,10H,1-3H3,(H,13,14) |
InChIKey | DAOGRNTZCLFPNH-UHFFFAOYSA-N |
SMILES | CC(C)(C)C(C1=CC=CC=C1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |