For research use only, not for therapeutic use.
3,3-Dimethylindoline(Cat No.:L039652)is a chemical compound with the molecular formula C10H13N. This organic compound is characterized by an indoline structure substituted with two methyl groups at the 3-position, enhancing its steric bulk and electronic properties. It is widely used in the synthesis of dyes, pharmaceuticals, and organic light-emitting diodes (OLEDs). The dimethyl groups contribute to its stability and influence its reactivity, making it a versatile intermediate in organic synthesis. Additionally, 3,3-dimethylindoline plays a crucial role in the preparation of various indole derivatives, which are important in medicinal chemistry for their biological activities.
Catalog Number | L039652 |
CAS Number | 1914-02-9 |
Molecular Formula | C10H13N |
Purity | ≥95% |
IUPAC Name | 3,3-dimethyl-1,2-dihydroindole |
InChI | InChI=1S/C10H13N/c1-10(2)7-11-9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3 |
InChIKey | SRCCLYMWDRNUAF-UHFFFAOYSA-N |
SMILES | CC1(CNC2=CC=CC=C21)C |