For research use only. Not for therapeutic Use.
3,3-Dimethyltetrahydro-2H-pyran-4-ol(CAT: L048896) is a heterocyclic compound with a tetrahydropyran ring substituted with two methyl groups at the 3-position and a hydroxyl group at the 4-position. This compound is widely used as an intermediate in pharmaceutical and chemical synthesis. Its unique structure offers versatility in the development of bioactive molecules, such as enzyme inhibitors, and as a precursor in the synthesis of complex organic compounds. With high purity and excellent stability, 3,3-Dimethyltetrahydro-2H-pyran-4-ol serves as a reliable reagent for researchers engaged in innovative drug discovery and organic chemistry projects.
CAS Number | 2092545-21-4 |
Molecular Formula | C7H14O2 |
Purity | ≥95% |
IUPAC Name | 3,3-dimethyloxan-4-ol |
InChI | InChI=1S/C7H14O2/c1-7(2)5-9-4-3-6(7)8/h6,8H,3-5H2,1-2H3 |
InChIKey | CQJFCJPBJHSCFI-UHFFFAOYSA-N |
SMILES | CC1(COCCC1O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |