Home
>
Materials Science>Organic ligands for MOF materials> 3,3',3''-(Benzene-1,3,5-triyl)triacrylic acid
For research use only. Not for therapeutic Use.
3,3′,3”-(Benzene-1,3,5-triyl)triacrylic acid (Cat.No:L003740) is a vital chemical compound in materials science. Its unique triacrylic structure offers exceptional reactivity. This compound is employed as a crucial component in the synthesis of specialized polymers and materials, finding applications in various industries. Its versatile nature and distinctive properties make it an indispensable building block in the development of advanced materials for areas such as coatings, adhesives, and biomedical applications, underscoring its significance in contemporary chemical research.
CAS Number | 41009-88-5 |
Molecular Formula | C15H12O6 |
Purity | ≥95% |
IUPAC Name | (E)-3-[3,5-bis[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
InChI | InChI=1S/C15H12O6/c16-13(17)4-1-10-7-11(2-5-14(18)19)9-12(8-10)3-6-15(20)21/h1-9H,(H,16,17)(H,18,19)(H,20,21)/b4-1+,5-2+,6-3+ |
InChIKey | OYJYITDWCXDYQZ-GZDDRBCLSA-N |
SMILES | C1=C(C=C(C=C1/C=C/C(=O)O)/C=C/C(=O)O)/C=C/C(=O)O |