For research use only. Not for therapeutic Use.
3,3′,3”-Nitrilotripropionic Acid is a versatile organic compound featuring three propionic acid moieties linked by a nitrile group. This triacid is significant in biochemistry and organic synthesis, often used as a chelating agent and in the preparation of buffer solutions. Its structure allows for the formation of metal complexes, enhancing its application in analytical chemistry and biotechnological processes. Additionally, it can serve as a building block for the synthesis of various pharmaceuticals and agrochemicals, contributing to diverse chemical research applications.
CAS Number | 817-11-8 |
Molecular Formula | C9H15NO6 |
Purity | ≥95% |
IUPAC Name | 3-[bis(2-carboxyethyl)amino]propanoic acid |
InChI | InChI=1S/C9H15NO6/c11-7(12)1-4-10(5-2-8(13)14)6-3-9(15)16/h1-6H2,(H,11,12)(H,13,14)(H,15,16) |
InChIKey | IWTIBPIVCKUAHK-UHFFFAOYSA-N |
SMILES | C(CN(CCC(=O)O)CCC(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |