For research use only. Not for therapeutic Use.
3,3,3-Trifluoro-1-(4-fluorophenyl)propan-1-one(Cat No.:L007631), is a chemical compound characterized by a trifluoromethyl ketone group attached to a propanone backbone, with a fluorophenyl group at the 1-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a valuable intermediate for the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals.
CAS Number | 213594-77-5 |
Molecular Formula | C9H6F4O |
Purity | ≥95% |
IUPAC Name | 3,3,3-trifluoro-1-(4-fluorophenyl)propan-1-one |
InChI | InChI=1S/C9H6F4O/c10-7-3-1-6(2-4-7)8(14)5-9(11,12)13/h1-4H,5H2 |
InChIKey | FWDLSJLKYUHRED-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)CC(F)(F)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |