For research use only. Not for therapeutic Use.
3,3′,5,5′-Tetraethynyl-1,1′-biphenyl (Cat.No:L003647) is a pivotal chemical compound with significant applications in materials science. Its unique structure, featuring multiple acetylene groups, makes it a versatile building block for the synthesis of conjugated polymers and organic electronic materials. This compound’s high thermal stability and electronic properties contribute to its importance in the development of advanced materials for applications in optoelectronics, organic electronics, and other emerging technologies.
CAS Number | 189619-31-6 |
Molecular Formula | C20H10 |
Purity | ≥95% |
IUPAC Name | 1-(3,5-diethynylphenyl)-3,5-diethynylbenzene |
InChI | InChI=1S/C20H10/c1-5-15-9-16(6-2)12-19(11-15)20-13-17(7-3)10-18(8-4)14-20/h1-4,9-14H |
InChIKey | RVWOQPYCLALQNB-UHFFFAOYSA-N |
SMILES | C#CC1=CC(=CC(=C1)C2=CC(=CC(=C2)C#C)C#C)C#C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |