Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds> [3,4-Bis(benzyloxy)phenyl]-1,2-ethanediol-d5
For research use only. Not for therapeutic Use.
[3,4-Bis(benzyloxy)phenyl]-1,2-ethanediol-d5(Cat No.:R056646) is a deuterated version of [3,4-Bis(benzyloxy)phenyl]-1,2-ethanediol, where five hydrogen atoms are replaced with deuterium. This isotopic labeling significantly enhances the compound’s chemical stability and analytical traceability, making it ideal for advanced spectroscopic studies such as NMR and mass spectrometry. The compound features benzyloxy groups attached to a phenyl ring, enhancing its utility in synthetic organic chemistry and material science for studying molecular interactions and reaction mechanisms.
CAS Number | 1794960-44-3 |
Synonyms | 1-[3,4-Bis(phenylmethoxy)phenyl]-1,2-ethanediol-d5; rac 3,4-Bis(benzyloxy)phenylethylene Glycol-d5 |
Molecular Formula | C22H22O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1-dideuterio-2-[2,3,6-trideuterio-4,5-bis(phenylmethoxy)phenyl]ethane-1,2-diol |
InChI | InChI=1S/C22H22O4/c23-14-20(24)19-11-12-21(25-15-17-7-3-1-4-8-17)22(13-19)26-16-18-9-5-2-6-10-18/h1-13,20,23-24H,14-16H2/i11D,12D,13D,14D2 |
InChIKey | TUPSTLDQFNUXKF-HQMUZNGPSA-N |
SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(CO)O)OCC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |