For research use only. Not for therapeutic Use.
3,4-Diaminobenzimidamide hydrochloride(Cat No.:L037688)is a high-purity compound widely used in pharmaceutical and chemical research. This molecule features a benzimidamide core with two amino groups at the 3 and 4 positions, making it a versatile intermediate in the synthesis of bioactive molecules, particularly in drug development. The hydrochloride salt form enhances its solubility and stability, making it suitable for various experimental conditions. 3,4-Diaminobenzimidamide hydrochloride is essential for precise synthetic applications, supporting innovative research and the development of novel therapeutic agents in medicinal chemistry.
CAS Number | 66717-58-6 |
Molecular Formula | C7H11ClN4 |
Purity | ≥95% |
IUPAC Name | 3,4-diaminobenzenecarboximidamide;hydrochloride |
InChI | InChI=1S/C7H10N4.ClH/c8-5-2-1-4(7(10)11)3-6(5)9;/h1-3H,8-9H2,(H3,10,11);1H |
InChIKey | NALOATHCWHOMCS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=N)N)N)N.Cl |