For research use only. Not for therapeutic Use.
3,4-Dibenzyloxybenzaldehyde (Cat No.:R002974) is a chemical compound. It is a derivative of benzaldehyde, featuring two benzyloxy groups substituted at positions 3 and 4 of the benzene ring. This compound is used as an intermediate in organic synthesis, particularly in the preparation of various organic molecules and pharmaceuticals. Its modified benzaldehyde structure enhances its reactivity and versatility in chemical reactions, making it valuable for creating diverse compounds. 3,4-Dibenzyloxybenzaldehyde’s importance lies in its contribution to the development of functional compounds with potential applications across industries, including the pharmaceutical and chemical sectors.
CAS Number | 5447-02-9 |
Synonyms | 3,4-Bis(phenylmethoxy)benzaldehyde; NSC 16747; Protocatechualdehyde Dibenzyl Ether; α,α’-Diphenylveratraldehyde; |
Molecular Formula | C21H18O3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 3,4-bis(phenylmethoxy)benzaldehyde |
InChI | InChI=1S/C21H18O3/c22-14-19-11-12-20(23-15-17-7-3-1-4-8-17)21(13-19)24-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
InChIKey | XDDLXZHBWVFPRG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C=O)OCC3=CC=CC=C3 |