For research use only. Not for therapeutic Use.
3,4-Dicaffeoylquinic acid(Cat No.:I001752)is a naturally occurring polyphenolic compound found in various plants, particularly in the coffee and sunflower species. It belongs to the family of dicaffeoylquinic acids and is known for its potent antioxidant and anti-inflammatory properties. This compound plays a significant role in cellular protection against oxidative stress, which is linked to various chronic diseases. Due to its health benefits, 3,4-Dicaffeoylquinic acid is often studied in the context of preventing neurodegenerative disorders, cardiovascular diseases, and other inflammation-related conditions. Its potential therapeutic applications continue to be explored in pharmacological research.
CAS Number | 14534-61-3 |
Molecular Formula | C25H24O12 |
Purity | ≥95% |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | (1S,3R,4R,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,5-dihydroxycyclohexane-1-carboxylic acid |
InChI | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20-,23-,25+/m1/s1 |
InChIKey | UFCLZKMFXSILNL-PSEXTPKNSA-N |
SMILES | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O |
Reference | <p style=/line-height:25px/> |