For research use only. Not for therapeutic Use.
3,4-Dichloro-1-naphthalenol (CAT: L000176) is a chemical compound with applications primarily in organic chemistry and material science. Its action mechanism involves serving as a versatile intermediate for various chemical reactions. In organic chemistry, this compound is instrumental in the synthesis of specialty chemicals, pharmaceutical intermediates, and other complex molecules. Its importance lies in its role as a building block for creating compounds with specific properties.
CAS Number | 58877-90-0 |
Molecular Formula | C10H6Cl2O |
Purity | ≥95% |
IUPAC Name | 3,4-dichloronaphthalen-1-ol |
InChI | InChI=1S/C10H6Cl2O/c11-8-5-9(13)6-3-1-2-4-7(6)10(8)12/h1-5,13H |
InChIKey | FNSPLJCRSIZXGJ-UHFFFAOYSA-N |