Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates>
>
3,4-Dichloroaniline-13C6
For research use only. Not for therapeutic Use.
3,4-Dichloroaniline-13C6 is an isotopically labeled compound, where all six carbon atoms are enriched with the stable carbon-13 isotope. This compound is essential for advanced analytical studies, particularly in environmental and pharmaceutical research, where it is used to trace and quantify the behavior and fate of 3,4-dichloroaniline in various systems. The 13C labeling allows for precise detection and differentiation in mass spectrometry, making it invaluable for studying the compound’s degradation, metabolism, and environmental impact. Researchers rely on 3,4-Dichloroaniline-13C6 to gain accurate insights into its role in chemical reactions and its influence on biological processes.
Catalog Number | R011674 |
CAS Number | 89059-40-5 |
Synonyms | 3,4-Dichlorobenzenamine-1,2,3,4,5,6-13C6; 3,4-Dichlorophenylamine-13C6; 4,5-Dichloroaniline-13C6; 4-Amino-1,2-dichlorobenzene-13C6; DCA-13C6; LY 004892-13C6; NSC 247-13C6; m,p-Dichloroaniline-13C6; |
Molecular Formula | C6H5Cl2N |
Purity | ≥95% |
Storage | 2°C to 8°C |
IUPAC Name | 3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
InChI | InChI=1S/C6H5Cl2N/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | SDYWXFYBZPNOFX-IDEBNGHGSA-N |
SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1N)Cl)Cl |