For research use only. Not for therapeutic Use.
3,4-Dichlorobenzene-1-carboximidamide hydrochloride(Cat No.:L007421), is a chemical compound. This compound belongs to the class of organic compounds known as benzene and substituted derivatives, specifically dichlorobenzenes. The hydrochloride salt form indicates its chemical reactivity and solubility properties. As a specific derivative of dichlorobenzene, it may have applications in various chemical processes or research contexts, but its exact applications would depend on its unique properties, which might include its reactivity, stability, or catalytic potential.
CAS Number | 50292-25-6 |
Molecular Formula | C7H7Cl3N2 |
Purity | ≥95% |
IUPAC Name | 3,4-dichlorobenzenecarboximidamide;hydrochloride |
InChI | InChI=1S/C7H6Cl2N2.ClH/c8-5-2-1-4(7(10)11)3-6(5)9;/h1-3H,(H3,10,11);1H |
InChIKey | BMKBQAJRZBGARG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=N)N)Cl)Cl.Cl |