For research use only. Not for therapeutic Use.
3,4-Dichlorobenzoyl chloride is a chemical compound used in organic synthesis as an acyl chloride reagent. This compound features chloro substituents on the benzene ring at positions 3 and 4, along with a reactive acyl chloride functional group. 3,4-Dichlorobenzoyl chloride is employed in the production of pharmaceuticals, agrochemicals, and specialty chemicals. It serves as a versatile building block for introducing the benzoyl group into various molecules through acylation reactions. Research focuses on optimizing synthetic routes and exploring its applications in the synthesis of complex organic compounds for industrial and research purposes.
CAS Number | 3024-72-4 |
Synonyms | 3,4-Dichloro-benzoyl Chloride |
Molecular Formula | C7H3Cl3O |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 3,4-dichlorobenzoyl chloride |
InChI | InChI=1S/C7H3Cl3O/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H |
InChIKey | VTXNOVCTHUBABW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)Cl)Cl)Cl |