For research use only. Not for therapeutic Use.
3,4-dichlorophenylbiguanide(Cat No.:M077314) is a chemical compound derived from biguanide, featuring a phenyl ring with two chlorine atoms attached at positions 3 and 4. It belongs to the biguanide class of compounds, known for their antiseptic and antimicrobial properties. 3,4-dichlorophenylbiguanide exhibits broad-spectrum antibacterial activity and is commonly used in various pharmaceutical and healthcare products, including antiseptics, disinfectants, and topical antimicrobial agents. Its effectiveness against a wide range of bacteria makes it valuable in the treatment and prevention of infections in both medical and consumer applications.
CAS Number | 15233-34-8 |
Synonyms | 3,4-dichlorophenylbiguanide |
Molecular Formula | C8H9Cl2N5 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine |
InChI | InChI=1S/C8H9Cl2N5/c9-5-2-1-4(3-6(5)10)14-8(13)15-7(11)12/h1-3H,(H6,11,12,13,14,15) |
InChIKey | ZJAWVBLMRPEUPW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N=C(N)N=C(N)N)Cl)Cl |