For research use only. Not for therapeutic Use.
3,4′-Dichloropropiophenone(CAT: L011137) is an aromatic ketone featuring a propiophenone backbone with chlorine atoms substituted at the 3- and 4′-positions. This compound is a versatile intermediate widely used in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure allows for diverse chemical modifications, making it suitable for the development of bioactive molecules, such as enzyme inhibitors and receptor modulators. With high purity and consistent quality, 3,4′-Dichloropropiophenone is a reliable building block for researchers engaged in advanced organic synthesis and medicinal chemistry projects.
| Catalog Number | L011137 |
| CAS Number | 3946-29-0 |
| Molecular Formula | C9H8Cl2O |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-1-(4-chlorophenyl)propan-1-one |
| InChI | InChI=1S/C9H8Cl2O/c10-6-5-9(12)7-1-3-8(11)4-2-7/h1-4H,5-6H2 |
| InChIKey | AYFJBHFMQODYBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCl)Cl |
