For research use only. Not for therapeutic Use.
3,4-Difluoro-5-methoxybenzaldehyde(Cat No.:L032394)is a fluorinated benzaldehyde derivative distinguished by its methoxy and difluoro substitutions. This compound serves as a crucial intermediate in the synthesis of advanced pharmaceuticals and fine chemicals. The difluoro groups enhance the compound’s electronic properties, making it highly reactive towards nucleophilic addition, essential for building complex organic structures. Its methoxy group modifies the electronic effects on the benzene ring, aiding in selective synthetic transformations. Commonly used in the creation of antidepressants and antifungal agents, its versatile framework allows for innovative approaches in drug design and development.
CAS Number | 881190-46-1 |
Molecular Formula | C8H6F2O2 |
Purity | ≥95% |
IUPAC Name | 3,4-difluoro-5-methoxybenzaldehyde |
InChI | InChI=1S/C8H6F2O2/c1-12-7-3-5(4-11)2-6(9)8(7)10/h2-4H,1H3 |
InChIKey | FUBGAZPSMRFXLZ-UHFFFAOYSA-N |
SMILES | COC1=C(C(=CC(=C1)C=O)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |