For research use only. Not for therapeutic Use.
3,4-Dihydro-2H-1,4-benzoxazin-6-ol(CAT: L015313) is a high-purity heterocyclic compound characterized by a benzoxazine core with a hydroxyl group at the 6-position. This versatile molecule is widely used in pharmaceutical research and organic synthesis, particularly in the development of bioactive compounds, including enzyme inhibitors and therapeutic agents. Its unique structure and functional groups make it suitable for various chemical transformations and advanced material development. 3,4-Dihydro-2H-1,4-benzoxazin-6-ol supports innovative research in medicinal chemistry, fine chemical production, and material science applications.
CAS Number | 26021-57-8 |
Molecular Formula | C8H9NO2 |
Purity | ≥95% |
IUPAC Name | 3,4-dihydro-2H-1,4-benzoxazin-6-ol |
InChI | InChI=1S/C8H9NO2/c10-6-1-2-8-7(5-6)9-3-4-11-8/h1-2,5,9-10H,3-4H2 |
InChIKey | HWWIVWKTKZAORO-UHFFFAOYSA-N |
SMILES | C1COC2=C(N1)C=C(C=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |