For research use only. Not for therapeutic Use.
3,4-Dihydroxy-5-methoxybenzoic acid(CAT: R072366) is an organic compound with aromatic properties. Its mode of action involves serving as a derivative of gallic acid, which is a naturally occurring phenolic compound found in various plant sources. This compound exhibits pharmacologic actions, including antioxidant and anti-inflammatory properties. Due to its bioactive nature, it has potential applications in the development of natural health products and as a nutraceutical ingredient.
CAS Number | 3934-84-7 |
Molecular Formula | C8H8O5 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | 3,4-dihydroxy-5-methoxybenzoic acid |
InChI | InChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12) |
InChIKey | KWCCUYSXAYTNKA-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |