For research use only. Not for therapeutic Use.
3,4-Dihydroxy-5-nitrobenzoic Acid is a chemical compound used in pharmaceutical and biochemical research. Known for its antioxidant and anti-inflammatory properties, it serves as an intermediate in synthesizing various bioactive molecules. This compound is essential in studying metabolic pathways and developing new therapeutic agents, contributing to advancements in medicinal chemistry and drug discovery.
CAS Number | 84211-30-3 |
Synonyms | 3-Nitro-4,5-dihydroxybenzoic Acid |
Molecular Formula | C7H5NO6 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3,4-dihydroxy-5-nitrobenzoic acid |
InChI | InChI=1S/C7H5NO6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12) |
InChIKey | HDPSONAKHMNQPA-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)O)C(=O)O |