For research use only. Not for therapeutic Use.
3,4-Dihydroxybenzoic Acid Methyl Ester (CAT: R055048) is a chemical compound with potential applications in various fields, including organic synthesis and pharmaceutical research. Its structure consists of a benzoic acid core with hydroxyl groups attached at the 3rd and 4th positions, and a methyl ester group at the carboxyl group. The specific action target, mode of action, and pharmacologic action of this compound have not been explicitly mentioned in the provided data.
Catalog Number | R055048 |
CAS Number | 2150-43-8 |
Synonyms | Protocatechuic Acid Methyl Ester; 3,4-Dihydroxy MetDyl Benzoate; 3,4-Dihydroxybenzoic Acid Methyl Ester; Methyl 3,4-dihydroxybenzoate; Methyl Protocatechuate; NSC 146458; |
Molecular Formula | C8H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 3,4-dihydroxybenzoate |
InChI | InChI=1S/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
InChIKey | CUFLZUDASVUNOE-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C(C=C1)O)O |